C26H23BrN6O2 — CID 88888579
N-[(6-bromo-2-pyridinyl)methyl]-N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine (PubChem CID 88888579) has the molecular formula C26H23BrN6O2 and a molecular weight of 531.41 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 88888579 |
| Molecular Formula | C26H23BrN6O2 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
| SMILES | COc1cc(OC)cc(N(Cc2cccc(Br)n2)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1 |
| InChI | InChI=1S/C26H23BrN6O2/c1-32-15-17(13-29-32)25-14-28-23-8-7-19(11-24(23)31-25)33(16-18-5-4-6-26(27)30-18)20-9-21(34-2)12-22(10-20)35-3/h4-15H,16H2,1-3H3 |
| InChIKey | JBJLDYOTZAKYCV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|