C24H26F2N6O2 — CID 88888607
N-(2,2-difluoroethyl)-N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]ethane-1,2-diamine (PubChem CID 88888607) has the molecular formula C24H26F2N6O2 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]ethane-1,2-diamine.
| Compound Name | N-(2,2-difluoroethyl)-N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 88888607 |
| Molecular Formula | C24H26F2N6O2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-(2,2-difluoroethyl)-N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]ethane-1,2-diamine |
| SMILES | COc1cc(OC)cc(N(CCNCC(F)F)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1 |
| InChI | InChI=1S/C24H26F2N6O2/c1-31-15-16(12-29-31)23-13-28-21-5-4-17(10-22(21)30-23)32(7-6-27-14-24(25)26)18-8-19(33-2)11-20(9-18)34-3/h4-5,8-13,15,24,27H,6-7,14H2,1-3H3 |
| InChIKey | NEDQSDMNOSMYHF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|