About N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine
N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine (PubChem CID 88888767) has the molecular formula C23H45NO
and a molecular weight of 351.62 g/mol. Its IUPAC name is N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine |
| PubChem CID | 88888767 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(C)CNCC |
| InChI | InChI=1S/C23H45NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-23(3)22-24-5-2/h9-10,12-13,23-24H,4-8,11,14-22H2,1-3H3/b10-9-,13-12- |
| InChIKey | GYYWXRLQESMWPA-UTJQPWESSA-N |
| XLogP | 6.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine?
The IUPAC name of N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine (CID 88888767) is N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine.
What is the SMILES notation for N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine?
The canonical SMILES for N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine is CCCCC/C=C\C/C=C\CCCCCCCCOC(C)CNCC.
What is the InChIKey of N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine?
The InChIKey is GYYWXRLQESMWPA-UTJQPWESSA-N. The full InChI is InChI=1S/C23H45NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-23(3)22-24-5-2/h9-10,12-13,23-24H,4-8,11,14-22H2,1-3H3/b10-9-,13-12-.
What are the key properties of N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine?
N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine has a molecular weight of 351.62 g/mol, XLogP of 6.81, 19 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine is sourced from PubChem (CID 88888767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).