About (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine
(2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine (PubChem CID 88888771) has the molecular formula C25H49NO
and a molecular weight of 379.67 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine.
Molecular Properties
| Compound Name | (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine |
| PubChem CID | 88888771 |
| Molecular Formula | C25H49NO |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 379.38 |
| IUPAC Name | (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCCO[C@@H](C)CNCC |
| InChI | InChI=1S/C25H49NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-25(3)24-26-5-2/h9-10,12-13,25-26H,4-8,11,14-24H2,1-3H3/b10-9-,13-12-/t25-/m0/s1 |
| InChIKey | WXRJOSMXBQWJOI-YMVLYFQPSA-N |
| XLogP | 7.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine?
The IUPAC name of (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine (CID 88888771) is (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine.
What is the SMILES notation for (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine?
The canonical SMILES for (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine is CCCCC/C=C\C/C=C\CCCCCCCCCCO[C@@H](C)CNCC.
What is the InChIKey of (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine?
The InChIKey is WXRJOSMXBQWJOI-YMVLYFQPSA-N. The full InChI is InChI=1S/C25H49NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-25(3)24-26-5-2/h9-10,12-13,25-26H,4-8,11,14-24H2,1-3H3/b10-9-,13-12-/t25-/m0/s1.
What are the key properties of (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine?
(2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine has a molecular weight of 379.67 g/mol, XLogP of 7.59, 21 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-ethyl-2-[(11Z,14Z)-icosa-11,14-dienoxy]propan-1-amine is sourced from PubChem (CID 88888771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).