C24H33F3N6O3 — CID 88888993
N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]penta-2,4-dien-2-yl]methanimidamide (PubChem CID 88888993) has the molecular formula C24H33F3N6O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]penta-2,4-dien-2-yl]methanimidamide.
| Compound Name | N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]penta-2,4-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 88888993 |
| Molecular Formula | C24H33F3N6O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]penta-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C(Nc1cccc(C(F)(F)F)n1)/C(C)=C(\N=C\N)C(=O)N1CCC(NC2CCOCC2OC)CC1 |
| InChI | InChI=1S/C24H33F3N6O3/c1-15(16(2)30-21-6-4-5-20(32-21)24(25,26)27)22(29-14-28)23(34)33-10-7-17(8-11-33)31-18-9-12-36-13-19(18)35-3/h4-6,14,17-19,31H,2,7-13H2,1,3H3,(H2,28,29)(H,30,32)/b22-15- |
| InChIKey | IEUWRHHMCZJKNU-JCMHNJIXSA-N |
| XLogP | 2.67 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|