C21H26F3N5O5S2 — CID 88889067
N-[6-[(1Z)-1-[amino(propan-2-yl)amino]buta-1,3-dienyl]-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-3-methylsulfanyl-N-methylsulfonylpropanamide (PubChem CID 88889067) has the molecular formula C21H26F3N5O5S2 and a molecular weight of 549.60 g/mol. Its IUPAC name is N-[6-[(1Z)-1-[amino(propan-2-yl)amino]buta-1,3-dienyl]-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-3-methylsulfanyl-N-methylsulfonylpropanamide.
| Compound Name | N-[6-[(1Z)-1-[amino(propan-2-yl)amino]buta-1,3-dienyl]-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-3-methylsulfanyl-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 88889067 |
| Molecular Formula | C21H26F3N5O5S2 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | N-[6-[(1Z)-1-[amino(propan-2-yl)amino]buta-1,3-dienyl]-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-3-methylsulfanyl-N-methylsulfonylpropanamide |
| SMILES | C=C/C=C(/c1cc2c(=O)n(N(C(=O)CCSC)S(C)(=O)=O)c(=O)[nH]c2cc1C(F)(F)F)N(N)C(C)C |
| InChI | InChI=1S/C21H26F3N5O5S2/c1-6-7-17(27(25)12(2)3)13-10-14-16(11-15(13)21(22,23)24)26-20(32)28(19(14)31)29(36(5,33)34)18(30)8-9-35-4/h6-7,10-12H,1,8-9,25H2,2-5H3,(H,26,32)/b17-7- |
| InChIKey | DKDVVFXKGWHKIO-IDUWFGFVSA-N |
| XLogP | 2.00 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|