About (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine
(1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine (PubChem CID 88889140) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine |
| PubChem CID | 88889140 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine |
| SMILES | C=C(CN)S/C=C(N)/C=C\C |
| InChI | InChI=1S/C8H14N2S/c1-3-4-8(10)6-11-7(2)5-9/h3-4,6H,2,5,9-10H2,1H3/b4-3-,8-6- |
| InChIKey | MBEQHVUQYPNNIM-XYMCEGRYSA-N |
| XLogP | 1.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine?
The IUPAC name of (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine (CID 88889140) is (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine.
What is the SMILES notation for (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine?
The canonical SMILES for (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine is C=C(CN)S/C=C(N)/C=C\C.
What is the InChIKey of (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine?
The InChIKey is MBEQHVUQYPNNIM-XYMCEGRYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-3-4-8(10)6-11-7(2)5-9/h3-4,6H,2,5,9-10H2,1H3/b4-3-,8-6-.
What are the key properties of (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine?
(1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine has a molecular weight of 170.28 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-1-(3-aminoprop-1-en-2-ylsulfanyl)penta-1,3-dien-2-amine is sourced from PubChem (CID 88889140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).