C37H33BO2 — CID 88889202
2-[6-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 88889202) has the molecular formula C37H33BO2 and a molecular weight of 520.48 g/mol. Its IUPAC name is 2-[6-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 88889202 |
| Molecular Formula | C37H33BO2 |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 2-[6-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4ccc5c(B6OC(C)(C)C(C)(C)O6)ccc6ccc3c4c65)cc21 |
| InChI | InChI=1S/C37H33BO2/c1-35(2)30-10-8-7-9-26(30)27-17-14-24(21-31(27)35)25-16-11-22-13-19-29-32(38-39-36(3,4)37(5,6)40-38)20-15-23-12-18-28(25)33(22)34(23)29/h7-21H,1-6H3 |
| InChIKey | OPENTWXRRSZXPA-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|