C12H16O4 — CID 88889239
(4S)-5-methyl-4-propyl-4,5,7,8-tetrahydrofuro[3,4-d]oxepine-1,3-dione (PubChem CID 88889239) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (4S)-5-methyl-4-propyl-4,5,7,8-tetrahydrofuro[3,4-d]oxepine-1,3-dione.
| Compound Name | (4S)-5-methyl-4-propyl-4,5,7,8-tetrahydrofuro[3,4-d]oxepine-1,3-dione |
|---|---|
| PubChem CID | 88889239 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (4S)-5-methyl-4-propyl-4,5,7,8-tetrahydrofuro[3,4-d]oxepine-1,3-dione |
| SMILES | CCC[C@H]1C2=C(CCOC1C)C(=O)OC2=O |
| InChI | InChI=1S/C12H16O4/c1-3-4-8-7(2)15-6-5-9-10(8)12(14)16-11(9)13/h7-8H,3-6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | HWEWEHOMPLTPDY-BRFYHDHCSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|