C12H16F3NO — CID 88889292
(2E,4E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoroethyl)hepta-2,4-dienamide (PubChem CID 88889292) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoroethyl)hepta-2,4-dienamide.
| Compound Name | (2E,4E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoroethyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 88889292 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoroethyl)hepta-2,4-dienamide |
| SMILES | C=C/C(=C\C=C(/C)CC)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c1-4-9(3)6-7-10(5-2)11(17)16-8-12(13,14)15/h5-7H,2,4,8H2,1,3H3,(H,16,17)/b9-6+,10-7+ |
| InChIKey | AJEQLFGMEOIYET-KZZDLZNXSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|