C13H19FN2O2 — CID 88889308
(2Z,4E)-N-[2-(dimethylamino)-2-oxoethyl]-2-[(E)-1-fluoroprop-1-enyl]hexa-2,4-dienamide (PubChem CID 88889308) has the molecular formula C13H19FN2O2 and a molecular weight of 254.31 g/mol. Its IUPAC name is (2Z,4E)-N-[2-(dimethylamino)-2-oxoethyl]-2-[(E)-1-fluoroprop-1-enyl]hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[2-(dimethylamino)-2-oxoethyl]-2-[(E)-1-fluoroprop-1-enyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 88889308 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2Z,4E)-N-[2-(dimethylamino)-2-oxoethyl]-2-[(E)-1-fluoroprop-1-enyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C(C(=O)NCC(=O)N(C)C)\C(F)=C/C |
| InChI | InChI=1S/C13H19FN2O2/c1-5-7-8-10(11(14)6-2)13(18)15-9-12(17)16(3)4/h5-8H,9H2,1-4H3,(H,15,18)/b7-5+,10-8+,11-6+ |
| InChIKey | RJOOHXWGGBSTGC-FVPVPMMFSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|