C17H23BrN6O2 — CID 88889390
2-[4-[4-(6-bromo-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 88889390) has the molecular formula C17H23BrN6O2 and a molecular weight of 423.32 g/mol. Its IUPAC name is 2-[4-[4-(6-bromo-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[4-(6-bromo-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 88889390 |
| Molecular Formula | C17H23BrN6O2 |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-[4-[4-(6-bromo-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(CCCCN2CCN(c3cccc(Br)n3)CC2)c1=O |
| InChI | InChI=1S/C17H23BrN6O2/c1-21-16(25)13-19-24(17(21)26)8-3-2-7-22-9-11-23(12-10-22)15-6-4-5-14(18)20-15/h4-6,13H,2-3,7-12H2,1H3 |
| InChIKey | VZGYMMOPAWNKDV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|