About 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine
3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine (PubChem CID 88889601) has the molecular formula C6H9NS2
and a molecular weight of 159.28 g/mol. Its IUPAC name is 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine.
Molecular Properties
| Compound Name | 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine |
| PubChem CID | 88889601 |
| Molecular Formula | C6H9NS2 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine |
| SMILES | C#CC1CCS(=S)N1C |
| InChI | InChI=1S/C6H9NS2/c1-3-6-4-5-9(8)7(6)2/h1,6H,4-5H2,2H3 |
| InChIKey | MLTVUHPGKURQAL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine?
The IUPAC name of 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine (CID 88889601) is 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine.
What is the SMILES notation for 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine?
The canonical SMILES for 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine is C#CC1CCS(=S)N1C.
What is the InChIKey of 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine?
The InChIKey is MLTVUHPGKURQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS2/c1-3-6-4-5-9(8)7(6)2/h1,6H,4-5H2,2H3.
What are the key properties of 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine?
3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine has a molecular weight of 159.28 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-2-methyl-1-sulfanylidene-1,2-thiazolidine is sourced from PubChem (CID 88889601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).