About 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide
5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide (PubChem CID 88889693) has the molecular formula C10H17O2P
and a molecular weight of 200.22 g/mol. Its IUPAC name is 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide.
Molecular Properties
| Compound Name | 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide |
| PubChem CID | 88889693 |
| Molecular Formula | C10H17O2P |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide |
| SMILES | C#CC1CC(C)(C)CP(=O)(OC)C1 |
| InChI | InChI=1S/C10H17O2P/c1-5-9-6-10(2,3)8-13(11,7-9)12-4/h1,9H,6-8H2,2-4H3 |
| InChIKey | KDXJQIAFIQHVFB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide?
The IUPAC name of 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide (CID 88889693) is 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide.
What is the SMILES notation for 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide?
The canonical SMILES for 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide is C#CC1CC(C)(C)CP(=O)(OC)C1.
What is the InChIKey of 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide?
The InChIKey is KDXJQIAFIQHVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O2P/c1-5-9-6-10(2,3)8-13(11,7-9)12-4/h1,9H,6-8H2,2-4H3.
What are the key properties of 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide?
5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide has a molecular weight of 200.22 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-1-methoxy-3,3-dimethyl-1λ5-phosphinane 1-oxide is sourced from PubChem (CID 88889693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).