About 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene
4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene (PubChem CID 88889914) has the molecular formula C6H6S2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene |
| PubChem CID | 88889914 |
| Molecular Formula | C6H6S2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 141.99 |
| IUPAC Name | 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene |
| SMILES | C#CC1=CS(=S)CC1 |
| InChI | InChI=1S/C6H6S2/c1-2-6-3-4-8(7)5-6/h1,5H,3-4H2 |
| InChIKey | FMKVAKMBPFHPMY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene?
The IUPAC name of 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene (CID 88889914) is 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene.
What is the SMILES notation for 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene?
The canonical SMILES for 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene is C#CC1=CS(=S)CC1.
What is the InChIKey of 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene?
The InChIKey is FMKVAKMBPFHPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6S2/c1-2-6-3-4-8(7)5-6/h1,5H,3-4H2.
What are the key properties of 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene?
4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene has a molecular weight of 142.25 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-1-sulfanylidene-2,3-dihydrothiophene is sourced from PubChem (CID 88889914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).