About 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide
4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide (PubChem CID 88890023) has the molecular formula C4H3FO3S
and a molecular weight of 150.13 g/mol. Its IUPAC name is 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide.
Molecular Properties
| Compound Name | 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide |
| PubChem CID | 88890023 |
| Molecular Formula | C4H3FO3S |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide |
| SMILES | O=S1OCC(C#CF)O1 |
| InChI | InChI=1S/C4H3FO3S/c5-2-1-4-3-7-9(6)8-4/h4H,3H2 |
| InChIKey | YIHXVCVWOPXPKU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide?
The IUPAC name of 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide (CID 88890023) is 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide.
What is the SMILES notation for 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide?
The canonical SMILES for 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide is O=S1OCC(C#CF)O1.
What is the InChIKey of 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide?
The InChIKey is YIHXVCVWOPXPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FO3S/c5-2-1-4-3-7-9(6)8-4/h4H,3H2.
What are the key properties of 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide?
4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide has a molecular weight of 150.13 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethynyl)-1,3,2-dioxathiolane 2-oxide is sourced from PubChem (CID 88890023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).