About 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide
4-ethynyl-4H-1,3,2-dioxathiine 2-oxide (PubChem CID 88890062) has the molecular formula C5H4O3S
and a molecular weight of 144.15 g/mol. Its IUPAC name is 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide.
Molecular Properties
| Compound Name | 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide |
| PubChem CID | 88890062 |
| Molecular Formula | C5H4O3S |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide |
| SMILES | C#CC1C=COS(=O)O1 |
| InChI | InChI=1S/C5H4O3S/c1-2-5-3-4-7-9(6)8-5/h1,3-5H |
| InChIKey | PFJJHUOKYJQCKL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide?
The IUPAC name of 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide (CID 88890062) is 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide.
What is the SMILES notation for 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide?
The canonical SMILES for 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide is C#CC1C=COS(=O)O1.
What is the InChIKey of 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide?
The InChIKey is PFJJHUOKYJQCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3S/c1-2-5-3-4-7-9(6)8-5/h1,3-5H.
What are the key properties of 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide?
4-ethynyl-4H-1,3,2-dioxathiine 2-oxide has a molecular weight of 144.15 g/mol, XLogP of 0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-4H-1,3,2-dioxathiine 2-oxide is sourced from PubChem (CID 88890062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).