About 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide
4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide (PubChem CID 88890097) has the molecular formula C7H7NO2S2
and a molecular weight of 201.27 g/mol. Its IUPAC name is 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide.
Molecular Properties
| Compound Name | 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide |
| PubChem CID | 88890097 |
| Molecular Formula | C7H7NO2S2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide |
| SMILES | C#CC1OS(=O)(=S)N(C)C1C#C |
| InChI | InChI=1S/C7H7NO2S2/c1-4-6-7(5-2)10-12(9,11)8(6)3/h1-2,6-7H,3H3 |
| InChIKey | QOEFXRWAVLKPAP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide?
The IUPAC name of 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide (CID 88890097) is 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide.
What is the SMILES notation for 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide?
The canonical SMILES for 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide is C#CC1OS(=O)(=S)N(C)C1C#C.
What is the InChIKey of 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide?
The InChIKey is QOEFXRWAVLKPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S2/c1-4-6-7(5-2)10-12(9,11)8(6)3/h1-2,6-7H,3H3.
What are the key properties of 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide?
4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide has a molecular weight of 201.27 g/mol, XLogP of -0.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethynyl-3-methyl-2-sulfanylideneoxathiazolidine 2-oxide is sourced from PubChem (CID 88890097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).