About 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide
6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 88890251) has the molecular formula C9H15O3P
and a molecular weight of 202.19 g/mol. Its IUPAC name is 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide.
Molecular Properties
| Compound Name | 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide |
| PubChem CID | 88890251 |
| Molecular Formula | C9H15O3P |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | C#CC1(C)CC(C)CP(=O)(OC)O1 |
| InChI | InChI=1S/C9H15O3P/c1-5-9(3)6-8(2)7-13(10,11-4)12-9/h1,8H,6-7H2,2-4H3 |
| InChIKey | YHKVXUREQOIVDK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
The IUPAC name of 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide (CID 88890251) is 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide.
What is the SMILES notation for 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
The canonical SMILES for 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide is C#CC1(C)CC(C)CP(=O)(OC)O1.
What is the InChIKey of 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
The InChIKey is YHKVXUREQOIVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O3P/c1-5-9(3)6-8(2)7-13(10,11-4)12-9/h1,8H,6-7H2,2-4H3.
What are the key properties of 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide has a molecular weight of 202.19 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-2-methoxy-4,6-dimethyl-1,2λ5-oxaphosphinane 2-oxide is sourced from PubChem (CID 88890251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).