C29H40F3N5O4 — CID 88890255
methyl N'-[(2Z)-1-[4-[[(3R,4R)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]carbamimidate (PubChem CID 88890255) has the molecular formula C29H40F3N5O4 and a molecular weight of 579.66 g/mol. Its IUPAC name is methyl N'-[(2Z)-1-[4-[[(3R,4R)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]carbamimidate.
| Compound Name | methyl N'-[(2Z)-1-[4-[[(3R,4R)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]carbamimidate |
|---|---|
| PubChem CID | 88890255 |
| Molecular Formula | C29H40F3N5O4 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | methyl N'-[(2Z)-1-[4-[[(3R,4R)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]carbamimidate |
| SMILES | C=C(/C(C)=C(\N=C(\N)OC)C(=O)N1CCC(N[C@@H]2CCOC[C@@H]2OC)CC1)N1CCc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C29H40F3N5O4/c1-18(19(2)37-11-7-20-5-6-22(29(30,31)32)15-21(20)16-37)26(35-28(33)40-4)27(38)36-12-8-23(9-13-36)34-24-10-14-41-17-25(24)39-3/h5-6,15,23-25,34H,2,7-14,16-17H2,1,3-4H3,(H2,33,35)/b26-18-/t24-,25+/m1/s1 |
| InChIKey | CVVLSPZUNRDMQZ-VRRJTVEGSA-N |
| XLogP | 3.20 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|