About 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide
3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide (PubChem CID 88890317) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide.
Molecular Properties
| Compound Name | 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide |
| PubChem CID | 88890317 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide |
| SMILES | C#CC1CS(=O)C=C1C |
| InChI | InChI=1S/C7H8OS/c1-3-7-5-9(8)4-6(7)2/h1,4,7H,5H2,2H3 |
| InChIKey | BPBWDBZHRPASAV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide?
The IUPAC name of 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide (CID 88890317) is 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide.
What is the SMILES notation for 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide?
The canonical SMILES for 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide is C#CC1CS(=O)C=C1C.
What is the InChIKey of 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide?
The InChIKey is BPBWDBZHRPASAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-3-7-5-9(8)4-6(7)2/h1,4,7H,5H2,2H3.
What are the key properties of 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide?
3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide has a molecular weight of 140.21 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-4-methyl-2,3-dihydrothiophene 1-oxide is sourced from PubChem (CID 88890317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).