C31H45N5O3 — CID 88890435
N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpenta-2,4-dien-2-yl]methanimidamide (PubChem CID 88890435) has the molecular formula C31H45N5O3 and a molecular weight of 535.73 g/mol. Its IUPAC name is N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpenta-2,4-dien-2-yl]methanimidamide.
| Compound Name | N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpenta-2,4-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 88890435 |
| Molecular Formula | C31H45N5O3 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | N'-[(2Z)-1-[4-[(3-methoxyoxan-4-yl)amino]piperidin-1-yl]-3-methyl-1-oxo-4-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpenta-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C(/C(C)=C(\N=C\N)C(=O)N1CCC(NC2CCOCC2OC)CC1)N1CCC2(CCc3ccccc32)CC1 |
| InChI | InChI=1S/C31H45N5O3/c1-22(23(2)35-17-13-31(14-18-35)12-8-24-6-4-5-7-26(24)31)29(33-21-32)30(37)36-15-9-25(10-16-36)34-27-11-19-39-20-28(27)38-3/h4-7,21,25,27-28,34H,2,8-20H2,1,3H3,(H2,32,33)/b29-22- |
| InChIKey | ROUCFKXATAKUSQ-IADYIPOJSA-N |
| XLogP | 3.13 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|