C22H29N5O4S — CID 88890588
4-[6-(butylamino)-1-[(4-hydroxycyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]benzenesulfonic acid (PubChem CID 88890588) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 4-[6-(butylamino)-1-[(4-hydroxycyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]benzenesulfonic acid.
| Compound Name | 4-[6-(butylamino)-1-[(4-hydroxycyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88890588 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 4-[6-(butylamino)-1-[(4-hydroxycyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]benzenesulfonic acid |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)O)cc3)nn(CC3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C22H29N5O4S/c1-2-3-12-23-22-24-13-19-20(16-6-10-18(11-7-16)32(29,30)31)26-27(21(19)25-22)14-15-4-8-17(28)9-5-15/h6-7,10-11,13,15,17,28H,2-5,8-9,12,14H2,1H3,(H,23,24,25)(H,29,30,31) |
| InChIKey | IEGRZSZMRKRFLU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|