C8H10F3N — CID 88890596
(2E)-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine (PubChem CID 88890596) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is (2E)-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine.
| Compound Name | (2E)-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 88890596 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (2E)-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)NC(=C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-4-5-6(2)12-7(3)8(9,10)11/h4-5,12H,1,3H2,2H3/b6-5+ |
| InChIKey | CXDILDZGVXXQGV-AATRIKPKSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|