About (1Z)-N,N-dimethylethanehydrazonoyl chloride
(1Z)-N,N-dimethylethanehydrazonoyl chloride (PubChem CID 88890719) has the molecular formula C4H9ClN2
and a molecular weight of 120.58 g/mol. Its IUPAC name is (1Z)-N,N-dimethylethanehydrazonoyl chloride.
Molecular Properties
| Compound Name | (1Z)-N,N-dimethylethanehydrazonoyl chloride |
| PubChem CID | 88890719 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | (1Z)-N,N-dimethylethanehydrazonoyl chloride |
| SMILES | C/C(Cl)=N/N(C)C |
| InChI | InChI=1S/C4H9ClN2/c1-4(5)6-7(2)3/h1-3H3/b6-4- |
| InChIKey | IHMAQAMJAZJHIT-XQRVVYSFSA-N |
| XLogP | 1.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-N,N-dimethylethanehydrazonoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-N,N-dimethylethanehydrazonoyl chloride?
The IUPAC name of (1Z)-N,N-dimethylethanehydrazonoyl chloride (CID 88890719) is (1Z)-N,N-dimethylethanehydrazonoyl chloride.
What is the SMILES notation for (1Z)-N,N-dimethylethanehydrazonoyl chloride?
The canonical SMILES for (1Z)-N,N-dimethylethanehydrazonoyl chloride is C/C(Cl)=N/N(C)C.
What is the InChIKey of (1Z)-N,N-dimethylethanehydrazonoyl chloride?
The InChIKey is IHMAQAMJAZJHIT-XQRVVYSFSA-N. The full InChI is InChI=1S/C4H9ClN2/c1-4(5)6-7(2)3/h1-3H3/b6-4-.
What are the key properties of (1Z)-N,N-dimethylethanehydrazonoyl chloride?
(1Z)-N,N-dimethylethanehydrazonoyl chloride has a molecular weight of 120.58 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-N,N-dimethylethanehydrazonoyl chloride is sourced from PubChem (CID 88890719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).