(1Z)-N,N-dimethylethanehydrazonoyl chloride

C4H9ClN2 — CID 88890719

IUPAC(1Z)-N,N-dimethylethanehydrazonoyl chloride
SMILESC/C(Cl)=N/N(C)C
InChIInChI=1S/C4H9ClN2/c1-4(5)6-7(2)3/h1-3H3/b6-4-
InChIKeyIHMAQAMJAZJHIT-XQRVVYSFSA-N
MW120.58 g/mol
LogP1.12
Rot. Bonds1

About (1Z)-N,N-dimethylethanehydrazonoyl chloride

(1Z)-N,N-dimethylethanehydrazonoyl chloride (PubChem CID 88890719) has the molecular formula C4H9ClN2 and a molecular weight of 120.58 g/mol. Its IUPAC name is (1Z)-N,N-dimethylethanehydrazonoyl chloride.

Molecular Properties

Compound Name(1Z)-N,N-dimethylethanehydrazonoyl chloride
PubChem CID88890719
Molecular FormulaC4H9ClN2
Molecular Weight120.58 g/mol
Exact Mass120.05
IUPAC Name(1Z)-N,N-dimethylethanehydrazonoyl chloride
SMILESC/C(Cl)=N/N(C)C
InChIInChI=1S/C4H9ClN2/c1-4(5)6-7(2)3/h1-3H3/b6-4-
InChIKeyIHMAQAMJAZJHIT-XQRVVYSFSA-N
XLogP1.12
TPSA15.60 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.58
LogP ≤ 51.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (1Z)-N,N-dimethylethanehydrazonoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1Z)-N,N-dimethylethanehydrazonoyl chloride?
The IUPAC name of (1Z)-N,N-dimethylethanehydrazonoyl chloride (CID 88890719) is (1Z)-N,N-dimethylethanehydrazonoyl chloride.
What is the SMILES notation for (1Z)-N,N-dimethylethanehydrazonoyl chloride?
The canonical SMILES for (1Z)-N,N-dimethylethanehydrazonoyl chloride is C/C(Cl)=N/N(C)C.
What is the InChIKey of (1Z)-N,N-dimethylethanehydrazonoyl chloride?
The InChIKey is IHMAQAMJAZJHIT-XQRVVYSFSA-N. The full InChI is InChI=1S/C4H9ClN2/c1-4(5)6-7(2)3/h1-3H3/b6-4-.
What are the key properties of (1Z)-N,N-dimethylethanehydrazonoyl chloride?
(1Z)-N,N-dimethylethanehydrazonoyl chloride has a molecular weight of 120.58 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-N,N-dimethylethanehydrazonoyl chloride is sourced from PubChem (CID 88890719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).