C7H7F3O — CID 88890755
(3,4,5-trifluorocyclohexa-1,5-dien-1-yl)methanol (PubChem CID 88890755) has the molecular formula C7H7F3O and a molecular weight of 164.13 g/mol. Its IUPAC name is (3,4,5-trifluorocyclohexa-1,5-dien-1-yl)methanol.
| Compound Name | (3,4,5-trifluorocyclohexa-1,5-dien-1-yl)methanol |
|---|---|
| PubChem CID | 88890755 |
| Molecular Formula | C7H7F3O |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | (3,4,5-trifluorocyclohexa-1,5-dien-1-yl)methanol |
| SMILES | OCC1=CC(F)C(F)C(F)=C1 |
| InChI | InChI=1S/C7H7F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,5,7,11H,3H2 |
| InChIKey | ZQITXGCUQVCTMB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |