C23H45NO — CID 88890815
N-methyl-3-[(10Z,13Z)-16-methyloctadeca-10,13-dienoxy]propan-1-amine (PubChem CID 88890815) has the molecular formula C23H45NO and a molecular weight of 351.62 g/mol. Its IUPAC name is N-methyl-3-[(10Z,13Z)-16-methyloctadeca-10,13-dienoxy]propan-1-amine.
| Compound Name | N-methyl-3-[(10Z,13Z)-16-methyloctadeca-10,13-dienoxy]propan-1-amine |
|---|---|
| PubChem CID | 88890815 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | N-methyl-3-[(10Z,13Z)-16-methyloctadeca-10,13-dienoxy]propan-1-amine |
| SMILES | CCC(C)C/C=C\C/C=C\CCCCCCCCCOCCCNC |
| InChI | InChI=1S/C23H45NO/c1-4-23(2)19-16-14-12-10-8-6-5-7-9-11-13-15-17-21-25-22-18-20-24-3/h8,10,14,16,23-24H,4-7,9,11-13,15,17-22H2,1-3H3/b10-8-,16-14- |
| InChIKey | ZIUUOXSVUKVIQQ-UDJAPEQQSA-N |
| XLogP | 6.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|