C6H5Cl3 — CID 88891012
(3Z)-2,3,4-trichlorohexa-1,3,5-triene (PubChem CID 88891012) has the molecular formula C6H5Cl3 and a molecular weight of 183.46 g/mol. Its IUPAC name is (3Z)-2,3,4-trichlorohexa-1,3,5-triene.
| Compound Name | (3Z)-2,3,4-trichlorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 88891012 |
| Molecular Formula | C6H5Cl3 |
| Molecular Weight | 183.46 g/mol |
| Exact Mass | 181.95 |
| IUPAC Name | (3Z)-2,3,4-trichlorohexa-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(/Cl)C(=C)Cl |
| InChI | InChI=1S/C6H5Cl3/c1-3-5(8)6(9)4(2)7/h3H,1-2H2/b6-5- |
| InChIKey | SIUPJWRYSSWHOX-WAYWQWQTSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|