About 3-imino-4-methylpentane-1,2-diol
3-imino-4-methylpentane-1,2-diol (PubChem CID 88891082) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is 3-imino-4-methylpentane-1,2-diol.
Molecular Properties
| Compound Name | 3-imino-4-methylpentane-1,2-diol |
| PubChem CID | 88891082 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-imino-4-methylpentane-1,2-diol |
| SMILES | [H]/N=C(\C(C)C)C(O)CO |
| InChI | InChI=1S/C6H13NO2/c1-4(2)6(7)5(9)3-8/h4-5,7-9H,3H2,1-2H3/b7-6+ |
| InChIKey | GHLAHALEYGAKHB-VOTSOKGWSA-N |
| XLogP | 0.02 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4-methylpentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4-methylpentane-1,2-diol?
The IUPAC name of 3-imino-4-methylpentane-1,2-diol (CID 88891082) is 3-imino-4-methylpentane-1,2-diol.
What is the SMILES notation for 3-imino-4-methylpentane-1,2-diol?
The canonical SMILES for 3-imino-4-methylpentane-1,2-diol is [H]/N=C(\C(C)C)C(O)CO.
What is the InChIKey of 3-imino-4-methylpentane-1,2-diol?
The InChIKey is GHLAHALEYGAKHB-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H13NO2/c1-4(2)6(7)5(9)3-8/h4-5,7-9H,3H2,1-2H3/b7-6+.
What are the key properties of 3-imino-4-methylpentane-1,2-diol?
3-imino-4-methylpentane-1,2-diol has a molecular weight of 131.17 g/mol, XLogP of 0.02, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4-methylpentane-1,2-diol is sourced from PubChem (CID 88891082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).