C19H18F6O6 — CID 88891371
5-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (PubChem CID 88891371) has the molecular formula C19H18F6O6 and a molecular weight of 456.34 g/mol. Its IUPAC name is 5-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88891371 |
| Molecular Formula | C19H18F6O6 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 5-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2CC(C(C3CCC4C(=O)OC(=O)C4C3)(C(F)(F)F)C(F)(F)F)CCC12 |
| InChI | InChI=1S/C19H18F6O6/c20-18(21,22)17(19(23,24)25,7-1-3-9-11(5-7)15(28)30-13(9)26)8-2-4-10-12(6-8)16(29)31-14(10)27/h7-12H,1-6H2 |
| InChIKey | ONHVPFDVZCELCW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|