About (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane
(5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane (PubChem CID 88891756) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane.
Molecular Properties
| Compound Name | (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane |
| PubChem CID | 88891756 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane |
| SMILES | CC12CC13C[C@H]2C1OC13 |
| InChI | InChI=1S/C8H10O/c1-7-3-8(7)2-4(7)5-6(8)9-5/h4-6H,2-3H2,1H3/t4-,5?,6?,7?,8?/m0/s1 |
| InChIKey | GNSPUUHIDRLRNZ-DKBGPPMCSA-N |
| XLogP | 1.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane?
The IUPAC name of (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane (CID 88891756) is (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane.
What is the SMILES notation for (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane?
The canonical SMILES for (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane is CC12CC13C[C@H]2C1OC13.
What is the InChIKey of (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane?
The InChIKey is GNSPUUHIDRLRNZ-DKBGPPMCSA-N. The full InChI is InChI=1S/C8H10O/c1-7-3-8(7)2-4(7)5-6(8)9-5/h4-6H,2-3H2,1H3/t4-,5?,6?,7?,8?/m0/s1.
What are the key properties of (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane?
(5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane has a molecular weight of 122.17 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-6-methyl-3-oxatetracyclo[3.2.1.01,6.02,4]octane is sourced from PubChem (CID 88891756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).