C11H13I — CID 88891827
6-[(1Z,3Z)-4-iodobuta-1,3-dienyl]-2-methylcyclohexa-1,3-diene (PubChem CID 88891827) has the molecular formula C11H13I and a molecular weight of 272.13 g/mol. Its IUPAC name is 6-[(1Z,3Z)-4-iodobuta-1,3-dienyl]-2-methylcyclohexa-1,3-diene.
| Compound Name | 6-[(1Z,3Z)-4-iodobuta-1,3-dienyl]-2-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88891827 |
| Molecular Formula | C11H13I |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 6-[(1Z,3Z)-4-iodobuta-1,3-dienyl]-2-methylcyclohexa-1,3-diene |
| SMILES | CC1=CC(/C=C\C=C/I)CC=C1 |
| InChI | InChI=1S/C11H13I/c1-10-5-4-7-11(9-10)6-2-3-8-12/h2-6,8-9,11H,7H2,1H3/b6-2-,8-3- |
| InChIKey | OTZXBEAEBROKSM-QSPCKEPBSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|