C24H26F3N3O2 — CID 88891985
(1R,2S)-2-morpholin-4-yl-2-pyridin-2-yl-1-[2-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-pyridinyl]ethanol (PubChem CID 88891985) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is (1R,2S)-2-morpholin-4-yl-2-pyridin-2-yl-1-[2-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-pyridinyl]ethanol.
| Compound Name | (1R,2S)-2-morpholin-4-yl-2-pyridin-2-yl-1-[2-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 88891985 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (1R,2S)-2-morpholin-4-yl-2-pyridin-2-yl-1-[2-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-pyridinyl]ethanol |
| SMILES | C=C(/C=C\C=C(/C)C(F)(F)F)c1ncccc1[C@@H](O)[C@H](c1ccccn1)N1CCOCC1 |
| InChI | InChI=1S/C24H26F3N3O2/c1-17(7-5-8-18(2)24(25,26)27)21-19(9-6-12-29-21)23(31)22(20-10-3-4-11-28-20)30-13-15-32-16-14-30/h3-12,22-23,31H,1,13-16H2,2H3/b7-5-,18-8+/t22-,23+/m0/s1 |
| InChIKey | WEJQTNPTEKDAQA-APPJUNANSA-N |
| XLogP | 4.66 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|