C21H27FN2O — CID 88891993
(E,2E)-2-ethylidene-4-fluoro-N-[[4-[(2Z,4Z)-hepta-2,4,6-trienyl]piperidin-4-yl]methyl]hex-3-en-5-ynamide (PubChem CID 88891993) has the molecular formula C21H27FN2O and a molecular weight of 342.46 g/mol. Its IUPAC name is (E,2E)-2-ethylidene-4-fluoro-N-[[4-[(2Z,4Z)-hepta-2,4,6-trienyl]piperidin-4-yl]methyl]hex-3-en-5-ynamide.
| Compound Name | (E,2E)-2-ethylidene-4-fluoro-N-[[4-[(2Z,4Z)-hepta-2,4,6-trienyl]piperidin-4-yl]methyl]hex-3-en-5-ynamide |
|---|---|
| PubChem CID | 88891993 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (E,2E)-2-ethylidene-4-fluoro-N-[[4-[(2Z,4Z)-hepta-2,4,6-trienyl]piperidin-4-yl]methyl]hex-3-en-5-ynamide |
| SMILES | C#C/C(F)=C\C(=C/C)C(=O)NCC1(C/C=C\C=C/C=C)CCNCC1 |
| InChI | InChI=1S/C21H27FN2O/c1-4-7-8-9-10-11-21(12-14-23-15-13-21)17-24-20(25)18(5-2)16-19(22)6-3/h3-5,7-10,16,23H,1,11-15,17H2,2H3,(H,24,25)/b8-7-,10-9-,18-5+,19-16+ |
| InChIKey | PRNXWXFRYZWDHF-VOTFFUMXSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|