C17H26N2 — CID 88892156
1,3-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-4,5-dihydro-2H-benzimidazole (PubChem CID 88892156) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-4,5-dihydro-2H-benzimidazole.
| Compound Name | 1,3-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-4,5-dihydro-2H-benzimidazole |
|---|---|
| PubChem CID | 88892156 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1,3-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-4,5-dihydro-2H-benzimidazole |
| SMILES | C/C=C(\C=C/C(C)C)C1N(C)C2=C(CCC=C2)N1C |
| InChI | InChI=1S/C17H26N2/c1-6-14(12-11-13(2)3)17-18(4)15-9-7-8-10-16(15)19(17)5/h6-7,9,11-13,17H,8,10H2,1-5H3/b12-11-,14-6+ |
| InChIKey | UCGHMFKUUXVDAD-WECMCUSASA-N |
| XLogP | 3.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|