C14H16N2 — CID 88892180
8-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 88892180) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 8-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 8-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 88892180 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 8-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C=C/C=C\C=C/Cn1[nH]c2ccc(C)cc21 |
| InChI | InChI=1S/C14H16N2/c1-3-4-5-6-7-10-16-14-11-12(2)8-9-13(14)15-16/h3-9,11,15H,1,10H2,2H3/b5-4-,7-6- |
| InChIKey | FOVHXJLJZHQTFF-RZSVFLSASA-N |
| XLogP | 3.58 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|