C15H22N2 — CID 88892209
1-N'-cyclohexa-1,3-dien-1-yl-1-cyclohexa-1,5-dien-1-yl-1-N-methylethane-1,1-diamine (PubChem CID 88892209) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-N'-cyclohexa-1,3-dien-1-yl-1-cyclohexa-1,5-dien-1-yl-1-N-methylethane-1,1-diamine.
| Compound Name | 1-N'-cyclohexa-1,3-dien-1-yl-1-cyclohexa-1,5-dien-1-yl-1-N-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 88892209 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-N'-cyclohexa-1,3-dien-1-yl-1-cyclohexa-1,5-dien-1-yl-1-N-methylethane-1,1-diamine |
| SMILES | CNC(C)(NC1=CC=CCC1)C1=CCCC=C1 |
| InChI | InChI=1S/C15H22N2/c1-15(16-2,13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h4-5,7,9-11,16-17H,3,6,8,12H2,1-2H3 |
| InChIKey | HYIQYUBVVUMLBP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|