C10H13F3 — CID 88892285
(2Z,4E,6Z)-4-methyl-5-(trifluoromethyl)octa-2,4,6-triene (PubChem CID 88892285) has the molecular formula C10H13F3 and a molecular weight of 190.21 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-methyl-5-(trifluoromethyl)octa-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-4-methyl-5-(trifluoromethyl)octa-2,4,6-triene |
|---|---|
| PubChem CID | 88892285 |
| Molecular Formula | C10H13F3 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2Z,4E,6Z)-4-methyl-5-(trifluoromethyl)octa-2,4,6-triene |
| SMILES | C/C=C\C(C)=C(/C=C\C)C(F)(F)F |
| InChI | InChI=1S/C10H13F3/c1-4-6-8(3)9(7-5-2)10(11,12)13/h4-7H,1-3H3/b6-4-,7-5-,9-8+ |
| InChIKey | PJRJIFWSOBZSQG-VHIIXJFGSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|