C15H17N — CID 88892345
1,1,2-trimethyl-5,5a-dihydrobenzo[e]indole (PubChem CID 88892345) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 1,1,2-trimethyl-5,5a-dihydrobenzo[e]indole.
| Compound Name | 1,1,2-trimethyl-5,5a-dihydrobenzo[e]indole |
|---|---|
| PubChem CID | 88892345 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1,1,2-trimethyl-5,5a-dihydrobenzo[e]indole |
| SMILES | CC1=NC2=CCC3C=CC=CC3=C2C1(C)C |
| InChI | InChI=1S/C15H17N/c1-10-15(2,3)14-12-7-5-4-6-11(12)8-9-13(14)16-10/h4-7,9,11H,8H2,1-3H3 |
| InChIKey | OKQJFRXIBTXGDE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |