C17H30N2O3 — CID 88892478
N-[(E)-2,5-dimethyl-6-oxohept-4-en-3-yl]-2-formamido-N,3,3-trimethylbutanamide (PubChem CID 88892478) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[(E)-2,5-dimethyl-6-oxohept-4-en-3-yl]-2-formamido-N,3,3-trimethylbutanamide.
| Compound Name | N-[(E)-2,5-dimethyl-6-oxohept-4-en-3-yl]-2-formamido-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 88892478 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | N-[(E)-2,5-dimethyl-6-oxohept-4-en-3-yl]-2-formamido-N,3,3-trimethylbutanamide |
| SMILES | CC(=O)/C(C)=C/C(C(C)C)N(C)C(=O)C(NC=O)C(C)(C)C |
| InChI | InChI=1S/C17H30N2O3/c1-11(2)14(9-12(3)13(4)21)19(8)16(22)15(18-10-20)17(5,6)7/h9-11,14-15H,1-8H3,(H,18,20)/b12-9+ |
| InChIKey | AGRYMTXURVONLJ-FMIVXFBMSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|