C21H25F2N3O4S2 — CID 88892682
2-[[2-[[cyclohexyl-[3-(3,4-difluorophenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid (PubChem CID 88892682) has the molecular formula C21H25F2N3O4S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[[2-[[cyclohexyl-[3-(3,4-difluorophenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[2-[[cyclohexyl-[3-(3,4-difluorophenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 88892682 |
| Molecular Formula | C21H25F2N3O4S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-[[2-[[cyclohexyl-[3-(3,4-difluorophenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1cnc(NC(=O)N(CCCOc2ccc(F)c(F)c2)C2CCCCC2)s1 |
| InChI | InChI=1S/C21H25F2N3O4S2/c22-16-8-7-15(11-17(16)23)30-10-4-9-26(14-5-2-1-3-6-14)21(29)25-20-24-12-19(32-20)31-13-18(27)28/h7-8,11-12,14H,1-6,9-10,13H2,(H,27,28)(H,24,25,29) |
| InChIKey | XAVGGLHLMSETOF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|