C9H17NO2S — CID 88893096
3-[2-(methylamino)ethylsulfanyl]hexane-2,5-dione (PubChem CID 88893096) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 3-[2-(methylamino)ethylsulfanyl]hexane-2,5-dione.
| Compound Name | 3-[2-(methylamino)ethylsulfanyl]hexane-2,5-dione |
|---|---|
| PubChem CID | 88893096 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 3-[2-(methylamino)ethylsulfanyl]hexane-2,5-dione |
| SMILES | CNCCSC(CC(C)=O)C(C)=O |
| InChI | InChI=1S/C9H17NO2S/c1-7(11)6-9(8(2)12)13-5-4-10-3/h9-10H,4-6H2,1-3H3 |
| InChIKey | ZXYHYBXZZSUISM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|