C15H21N — CID 88893179
(4E,9Z,11Z)-5-ethyltrideca-4,9,11-trien-2-yn-6-imine (PubChem CID 88893179) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (4E,9Z,11Z)-5-ethyltrideca-4,9,11-trien-2-yn-6-imine.
| Compound Name | (4E,9Z,11Z)-5-ethyltrideca-4,9,11-trien-2-yn-6-imine |
|---|---|
| PubChem CID | 88893179 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (4E,9Z,11Z)-5-ethyltrideca-4,9,11-trien-2-yn-6-imine |
| SMILES | [H]/N=C(CC/C=C\C=C/C)/C(=C/C#CC)CC |
| InChI | InChI=1S/C15H21N/c1-4-7-9-10-11-13-15(16)14(6-3)12-8-5-2/h4,7,9-10,12,16H,6,11,13H2,1-3H3/b7-4-,10-9-,14-12+,16-15+ |
| InChIKey | PMMSWTUUOQPWRO-ZDMYLZAXSA-N |
| XLogP | 4.28 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|