C19H16F6O4 — CID 88893272
2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]acetaldehyde (PubChem CID 88893272) has the molecular formula C19H16F6O4 and a molecular weight of 422.32 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]acetaldehyde.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 88893272 |
| Molecular Formula | C19H16F6O4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]acetaldehyde |
| SMILES | O=CCOc1ccc(C(c2ccc(OCCO)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F6O4/c20-18(21,22)17(19(23,24)25,13-1-5-15(6-2-13)28-11-9-26)14-3-7-16(8-4-14)29-12-10-27/h1-9,27H,10-12H2 |
| InChIKey | YBVLDFHPXLKKES-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|