About tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate
tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate (PubChem CID 88893369) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate |
| PubChem CID | 88893369 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate |
| SMILES | C=C(/C=C\C(=C)C(C)CC)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26O3/c1-8-12(2)13(3)9-10-14(4)18-11-15(17)19-16(5,6)7/h9-10,12H,3-4,8,11H2,1-2,5-7H3/b10-9- |
| InChIKey | OYABQWSCTBOXSI-KTKRTIGZSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate?
The IUPAC name of tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate (CID 88893369) is tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate.
What is the SMILES notation for tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate?
The canonical SMILES for tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate is C=C(/C=C\C(=C)C(C)CC)OCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate?
The InChIKey is OYABQWSCTBOXSI-KTKRTIGZSA-N. The full InChI is InChI=1S/C16H26O3/c1-8-12(2)13(3)9-10-14(4)18-11-15(17)19-16(5,6)7/h9-10,12H,3-4,8,11H2,1-2,5-7H3/b10-9-.
What are the key properties of tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate?
tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate has a molecular weight of 266.38 g/mol, XLogP of 4.02, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3Z)-6-methyl-5-methylideneocta-1,3-dien-2-yl]oxyacetate is sourced from PubChem (CID 88893369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).