C11H22F3NO2S — CID 88893591
N-(2,7-dimethyloctyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 88893591) has the molecular formula C11H22F3NO2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(2,7-dimethyloctyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(2,7-dimethyloctyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 88893591 |
| Molecular Formula | C11H22F3NO2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(2,7-dimethyloctyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(C)CCCCC(C)CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2S/c1-9(2)6-4-5-7-10(3)8-15-18(16,17)11(12,13)14/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | GDKYZRTXZSZANT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|