C20H18F3N5O6 — CID 88893749
(6'S,7'S)-N-(2,2-difluoroethyl)-17'-fluoro-6'-methyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide (PubChem CID 88893749) has the molecular formula C20H18F3N5O6 and a molecular weight of 481.39 g/mol. Its IUPAC name is (6'S,7'S)-N-(2,2-difluoroethyl)-17'-fluoro-6'-methyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide.
| Compound Name | (6'S,7'S)-N-(2,2-difluoroethyl)-17'-fluoro-6'-methyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide |
|---|---|
| PubChem CID | 88893749 |
| Molecular Formula | C20H18F3N5O6 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (6'S,7'S)-N-(2,2-difluoroethyl)-17'-fluoro-6'-methyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide |
| SMILES | C[C@@H]1OCCN2c3c(cc4c(C(=O)NCC(F)F)noc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@@H]12 |
| InChI | InChI=1S/C20H18F3N5O6/c1-7-15-20(17(30)25-19(32)26-18(20)31)5-8-4-9-12(16(29)24-6-10(21)22)27-34-14(9)11(23)13(8)28(15)2-3-33-7/h4,7,10,15H,2-3,5-6H2,1H3,(H,24,29)(H2,25,26,30,31,32)/t7-,15+/m0/s1 |
| InChIKey | WRWQHYMCCYKCMJ-NZFNHWASSA-N |
| XLogP | 0.46 |
| TPSA | 142.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|