C15H28O4Si — CID 88894113
methyl (5R,6E,8E,10S)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate (PubChem CID 88894113) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is methyl (5R,6E,8E,10S)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate.
| Compound Name | methyl (5R,6E,8E,10S)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate |
|---|---|
| PubChem CID | 88894113 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | methyl (5R,6E,8E,10S)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate |
| SMILES | COC(=O)CCC[C@@H](O)/C=C/C=C/[C@H](O)C[Si](C)(C)C |
| InChI | InChI=1S/C15H28O4Si/c1-19-15(18)11-7-10-13(16)8-5-6-9-14(17)12-20(2,3)4/h5-6,8-9,13-14,16-17H,7,10-12H2,1-4H3/b8-5+,9-6+/t13-,14-/m0/s1 |
| InChIKey | ZYRSTEWQOGGXBP-QMZQISMRSA-N |
| XLogP | 2.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|