C18H32O4Si — CID 88894116
methyl (6Z,8E,10E,12S)-5,12-dihydroxy-7-methyl-13-trimethylsilyltrideca-6,8,10-trienoate (PubChem CID 88894116) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is methyl (6Z,8E,10E,12S)-5,12-dihydroxy-7-methyl-13-trimethylsilyltrideca-6,8,10-trienoate.
| Compound Name | methyl (6Z,8E,10E,12S)-5,12-dihydroxy-7-methyl-13-trimethylsilyltrideca-6,8,10-trienoate |
|---|---|
| PubChem CID | 88894116 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | methyl (6Z,8E,10E,12S)-5,12-dihydroxy-7-methyl-13-trimethylsilyltrideca-6,8,10-trienoate |
| SMILES | COC(=O)CCCC(O)/C=C(C)\C=C\C=C\[C@H](O)C[Si](C)(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-15(13-16(19)11-8-12-18(21)22-2)9-6-7-10-17(20)14-23(3,4)5/h6-7,9-10,13,16-17,19-20H,8,11-12,14H2,1-5H3/b9-6+,10-7+,15-13-/t16?,17-/m0/s1 |
| InChIKey | ZWBMCIZXLIMHIM-QOEMCEDJSA-N |
| XLogP | 3.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|