C16H30O4Si — CID 88894135
ethyl (5S,6E,8E,10R)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate (PubChem CID 88894135) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is ethyl (5S,6E,8E,10R)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate.
| Compound Name | ethyl (5S,6E,8E,10R)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate |
|---|---|
| PubChem CID | 88894135 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethyl (5S,6E,8E,10R)-5,10-dihydroxy-11-trimethylsilylundeca-6,8-dienoate |
| SMILES | CCOC(=O)CCC[C@H](O)/C=C/C=C/[C@@H](O)C[Si](C)(C)C |
| InChI | InChI=1S/C16H30O4Si/c1-5-20-16(19)12-8-11-14(17)9-6-7-10-15(18)13-21(2,3)4/h6-7,9-10,14-15,17-18H,5,8,11-13H2,1-4H3/b9-6+,10-7+/t14-,15-/m1/s1 |
| InChIKey | PQNUERKOQFIFCG-XLXWYHOOSA-N |
| XLogP | 2.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|